C12H17N3O3 — CID 62006034
methyl 2-[[2-(ethylcarbamoyl)-4-pyridinyl]-methylamino]acetate (PubChem CID 62006034) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl 2-[[2-(ethylcarbamoyl)-4-pyridinyl]-methylamino]acetate.
| Compound Name | methyl 2-[[2-(ethylcarbamoyl)-4-pyridinyl]-methylamino]acetate |
|---|---|
| PubChem CID | 62006034 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl 2-[[2-(ethylcarbamoyl)-4-pyridinyl]-methylamino]acetate |
| SMILES | CCNC(=O)c1cc(N(C)CC(=O)OC)ccn1 |
| InChI | InChI=1S/C12H17N3O3/c1-4-13-12(17)10-7-9(5-6-14-10)15(2)8-11(16)18-3/h5-7H,4,8H2,1-3H3,(H,13,17) |
| InChIKey | FJMHWNUJNCONRL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |