C17H35N3O — CID 62006571
2-[[1-(aminomethyl)-4-methylcyclohexyl]-ethylamino]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 62006571) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is 2-[[1-(aminomethyl)-4-methylcyclohexyl]-ethylamino]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[[1-(aminomethyl)-4-methylcyclohexyl]-ethylamino]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 62006571 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | 2-[[1-(aminomethyl)-4-methylcyclohexyl]-ethylamino]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)CC)C1(CN)CCC(C)CC1 |
| InChI | InChI=1S/C17H35N3O/c1-6-16(4,5)19-15(21)12-20(7-2)17(13-18)10-8-14(3)9-11-17/h14H,6-13,18H2,1-5H3,(H,19,21) |
| InChIKey | JURAEZIPZAASHP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |