C13H25F3N2O — CID 62006769
1-(aminomethyl)-N,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine (PubChem CID 62006769) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(aminomethyl)-N,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 62006769 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(aminomethyl)-N,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(CN)(N(C)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H25F3N2O/c1-11-4-3-5-12(8-11,9-17)18(2)6-7-19-10-13(14,15)16/h11H,3-10,17H2,1-2H3 |
| InChIKey | TWJGTAPDPFEGAU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|