About 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one
2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 62007871) has the molecular formula C17H17ClN2O
and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
Molecular Properties
| Compound Name | 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| PubChem CID | 62007871 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2cnc(Cc3cccc(Cl)c3)nc2C1 |
| InChI | InChI=1S/C17H17ClN2O/c1-17(2)8-14-13(15(21)9-17)10-19-16(20-14)7-11-4-3-5-12(18)6-11/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | SZJPJEHMFPMJIO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The IUPAC name of 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one (CID 62007871) is 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
What is the SMILES notation for 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The canonical SMILES for 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one is CC1(C)CC(=O)c2cnc(Cc3cccc(Cl)c3)nc2C1.
What is the InChIKey of 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The InChIKey is SZJPJEHMFPMJIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O/c1-17(2)8-14-13(15(21)9-17)10-19-16(20-14)7-11-4-3-5-12(18)6-11/h3-6,10H,7-9H2,1-2H3.
What are the key properties of 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one has a molecular weight of 300.79 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chlorophenyl)methyl]-7,7-dimethyl-6,8-dihydroquinazolin-5-one is sourced from PubChem (CID 62007871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).