C14H14ClN3 — CID 62008088
2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 62008088) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | 2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 62008088 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | NC1CCCc2nc(-c3cccc(Cl)c3)ncc21 |
| InChI | InChI=1S/C14H14ClN3/c15-10-4-1-3-9(7-10)14-17-8-11-12(16)5-2-6-13(11)18-14/h1,3-4,7-8,12H,2,5-6,16H2 |
| InChIKey | YFNYMJFVZSGMQR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |