C10H15N3 — CID 62009294
N-ethyl-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 62009294) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-ethyl-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | N-ethyl-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 62009294 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-ethyl-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | CCNC1CCCc2ncncc21 |
| InChI | InChI=1S/C10H15N3/c1-2-12-9-4-3-5-10-8(9)6-11-7-13-10/h6-7,9,12H,2-5H2,1H3 |
| InChIKey | VYCHQBFBHDONJR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |