C17H21N3O — CID 62009305
N-ethyl-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 62009305) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is N-ethyl-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | N-ethyl-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 62009305 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-ethyl-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | CCNC1CCCc2nc(-c3cccc(OC)c3)ncc21 |
| InChI | InChI=1S/C17H21N3O/c1-3-18-15-8-5-9-16-14(15)11-19-17(20-16)12-6-4-7-13(10-12)21-2/h4,6-7,10-11,15,18H,3,5,8-9H2,1-2H3 |
| InChIKey | CUDVHFPRSLBASH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |