About 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine
2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine (PubChem CID 62010113) has the molecular formula C14H16BrN3S
and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine.
Molecular Properties
| Compound Name | 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine |
| PubChem CID | 62010113 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine |
| SMILES | CC1(C)Cc2nc(-c3cc(Br)cs3)ncc2C(N)C1 |
| InChI | InChI=1S/C14H16BrN3S/c1-14(2)4-10(16)9-6-17-13(18-11(9)5-14)12-3-8(15)7-19-12/h3,6-7,10H,4-5,16H2,1-2H3 |
| InChIKey | NUBYIORGDWFVKA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The IUPAC name of 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine (CID 62010113) is 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine.
What is the SMILES notation for 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The canonical SMILES for 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine is CC1(C)Cc2nc(-c3cc(Br)cs3)ncc2C(N)C1.
What is the InChIKey of 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
The InChIKey is NUBYIORGDWFVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3S/c1-14(2)4-10(16)9-6-17-13(18-11(9)5-14)12-3-8(15)7-19-12/h3,6-7,10H,4-5,16H2,1-2H3.
What are the key properties of 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine?
2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine has a molecular weight of 338.27 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromothiophen-2-yl)-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-amine is sourced from PubChem (CID 62010113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).