C10H21F3N2O — CID 62010161
2-N-ethyl-2-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,2-diamine (PubChem CID 62010161) has the molecular formula C10H21F3N2O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-N-ethyl-2-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,2-diamine.
| Compound Name | 2-N-ethyl-2-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 62010161 |
| Molecular Formula | C10H21F3N2O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-N-ethyl-2-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1,2-diamine |
| SMILES | CCN(CCOCC(F)(F)F)C(C)(C)CN |
| InChI | InChI=1S/C10H21F3N2O/c1-4-15(9(2,3)7-14)5-6-16-8-10(11,12)13/h4-8,14H2,1-3H3 |
| InChIKey | UZDUMDCYISDFSB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|