About methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate
methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (PubChem CID 62010695) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate |
| PubChem CID | 62010695 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)Cc1ncon1 |
| InChI | InChI=1S/C8H13N3O3/c1-11(4-3-8(12)13-2)5-7-9-6-14-10-7/h6H,3-5H2,1-2H3 |
| InChIKey | NGILWQKYIXKEPF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The IUPAC name of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (CID 62010695) is methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The canonical SMILES for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is COC(=O)CCN(C)Cc1ncon1.
What is the InChIKey of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The InChIKey is NGILWQKYIXKEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-11(4-3-8(12)13-2)5-7-9-6-14-10-7/h6H,3-5H2,1-2H3.
What are the key properties of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate has a molecular weight of 199.21 g/mol, XLogP of 0.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is sourced from PubChem (CID 62010695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).