methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate

C8H13N3O3 — CID 62010695

IUPACmethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate
SMILESCOC(=O)CCN(C)Cc1ncon1
InChIInChI=1S/C8H13N3O3/c1-11(4-3-8(12)13-2)5-7-9-6-14-10-7/h6H,3-5H2,1-2H3
InChIKeyNGILWQKYIXKEPF-UHFFFAOYSA-N
MW199.21 g/mol
LogP0.06
Rot. Bonds5

About methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate

methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (PubChem CID 62010695) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate
PubChem CID62010695
Molecular FormulaC8H13N3O3
Molecular Weight199.21 g/mol
Exact Mass199.10
IUPAC Namemethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate
SMILESCOC(=O)CCN(C)Cc1ncon1
InChIInChI=1S/C8H13N3O3/c1-11(4-3-8(12)13-2)5-7-9-6-14-10-7/h6H,3-5H2,1-2H3
InChIKeyNGILWQKYIXKEPF-UHFFFAOYSA-N
XLogP0.06
TPSA68.46 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 50.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The IUPAC name of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (CID 62010695) is methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The canonical SMILES for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is COC(=O)CCN(C)Cc1ncon1.
What is the InChIKey of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The InChIKey is NGILWQKYIXKEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-11(4-3-8(12)13-2)5-7-9-6-14-10-7/h6H,3-5H2,1-2H3.
What are the key properties of methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate has a molecular weight of 199.21 g/mol, XLogP of 0.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is sourced from PubChem (CID 62010695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).