About ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate
ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (PubChem CID 62010847) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate |
| PubChem CID | 62010847 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(C)Cc1ncon1 |
| InChI | InChI=1S/C9H15N3O3/c1-3-14-9(13)4-5-12(2)6-8-10-7-15-11-8/h7H,3-6H2,1-2H3 |
| InChIKey | OEZBHNXOJJFINQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The IUPAC name of ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate (CID 62010847) is ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate.
What is the SMILES notation for ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The canonical SMILES for ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is CCOC(=O)CCN(C)Cc1ncon1.
What is the InChIKey of ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
The InChIKey is OEZBHNXOJJFINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-3-14-9(13)4-5-12(2)6-8-10-7-15-11-8/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate?
ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate has a molecular weight of 213.24 g/mol, XLogP of 0.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoate is sourced from PubChem (CID 62010847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).