C13H18BrN3O3 — CID 62011505
methyl 3-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-2-methylpropanoate (PubChem CID 62011505) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is methyl 3-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 62011505 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | methyl 3-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)CC(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-9(13(19)20-3)7-17(2)8-12(18)16-11-5-4-10(14)6-15-11/h4-6,9H,7-8H2,1-3H3,(H,15,16,18) |
| InChIKey | XSACKKZBXYIHRB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |