C14H26N2O3 — CID 62012122
methyl 4-[[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methylamino]butanoate (PubChem CID 62012122) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 4-[[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methylamino]butanoate.
| Compound Name | methyl 4-[[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methylamino]butanoate |
|---|---|
| PubChem CID | 62012122 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl 4-[[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methylamino]butanoate |
| SMILES | C=C(C)CN(CC)C(=O)CN(C)CCCC(=O)OC |
| InChI | InChI=1S/C14H26N2O3/c1-6-16(10-12(2)3)13(17)11-15(4)9-7-8-14(18)19-5/h2,6-11H2,1,3-5H3 |
| InChIKey | GAWCTEMOCHIICP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|