About 2-bromo-1,4-ditert-butylbenzene
2-bromo-1,4-ditert-butylbenzene (PubChem CID 620135) has the molecular formula C14H21Br
and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-bromo-1,4-ditert-butylbenzene.
Molecular Properties
| Compound Name | 2-bromo-1,4-ditert-butylbenzene |
| PubChem CID | 620135 |
| Molecular Formula | C14H21Br |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-bromo-1,4-ditert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C14H21Br/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9H,1-6H3 |
| InChIKey | JFRPIGCUUJRXMT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-1,4-ditert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,4-ditert-butylbenzene?
The IUPAC name of 2-bromo-1,4-ditert-butylbenzene (CID 620135) is 2-bromo-1,4-ditert-butylbenzene.
What is the SMILES notation for 2-bromo-1,4-ditert-butylbenzene?
The canonical SMILES for 2-bromo-1,4-ditert-butylbenzene is CC(C)(C)c1ccc(C(C)(C)C)c(Br)c1.
What is the InChIKey of 2-bromo-1,4-ditert-butylbenzene?
The InChIKey is JFRPIGCUUJRXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Br/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9H,1-6H3.
What are the key properties of 2-bromo-1,4-ditert-butylbenzene?
2-bromo-1,4-ditert-butylbenzene has a molecular weight of 269.23 g/mol, XLogP of 5.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,4-ditert-butylbenzene is sourced from PubChem (CID 620135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).