ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate

C13H23NO4 — CID 62013546

IUPACethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate
SMILESCCOC(=O)CN(C)CC1COC2(CCCC2)O1
InChIInChI=1S/C13H23NO4/c1-3-16-12(15)9-14(2)8-11-10-17-13(18-11)6-4-5-7-13/h11H,3-10H2,1-2H3
InChIKeyADMXUHSOBGBWLP-UHFFFAOYSA-N
MW257.33 g/mol
LogP1.17
Rot. Bonds5

About ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate

ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate (PubChem CID 62013546) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate
PubChem CID62013546
Molecular FormulaC13H23NO4
Molecular Weight257.33 g/mol
Exact Mass257.16
IUPAC Nameethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate
SMILESCCOC(=O)CN(C)CC1COC2(CCCC2)O1
InChIInChI=1S/C13H23NO4/c1-3-16-12(15)9-14(2)8-11-10-17-13(18-11)6-4-5-7-13/h11H,3-10H2,1-2H3
InChIKeyADMXUHSOBGBWLP-UHFFFAOYSA-N
XLogP1.17
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 51.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate?
The IUPAC name of ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate (CID 62013546) is ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate.
What is the SMILES notation for ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate?
The canonical SMILES for ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate is CCOC(=O)CN(C)CC1COC2(CCCC2)O1.
What is the InChIKey of ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate?
The InChIKey is ADMXUHSOBGBWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4/c1-3-16-12(15)9-14(2)8-11-10-17-13(18-11)6-4-5-7-13/h11H,3-10H2,1-2H3.
What are the key properties of ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate?
ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate has a molecular weight of 257.33 g/mol, XLogP of 1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,4-dioxaspiro[4.4]nonan-3-ylmethyl(methyl)amino]acetate is sourced from PubChem (CID 62013546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).