C15H30N2O2 — CID 62015247
2-[cyclopentyl(2-hydroxyethyl)amino]-N,N-dipropylacetamide (PubChem CID 62015247) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[cyclopentyl(2-hydroxyethyl)amino]-N,N-dipropylacetamide.
| Compound Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 62015247 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN(CCO)C1CCCC1 |
| InChI | InChI=1S/C15H30N2O2/c1-3-9-16(10-4-2)15(19)13-17(11-12-18)14-7-5-6-8-14/h14,18H,3-13H2,1-2H3 |
| InChIKey | MOBPILDFEMCDBK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |