About 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol
1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol (PubChem CID 62015350) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 62015350 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)Cc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C13H18N2O4/c1-15(8-11(16)9-17-2)7-10-6-13(19-14-10)12-4-3-5-18-12/h3-6,11,16H,7-9H2,1-2H3 |
| InChIKey | DPYIPBAFNGZHOS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol (CID 62015350) is 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol is COCC(O)CN(C)Cc1cc(-c2ccco2)on1.
What is the InChIKey of 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The InChIKey is DPYIPBAFNGZHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-15(8-11(16)9-17-2)7-10-6-13(19-14-10)12-4-3-5-18-12/h3-6,11,16H,7-9H2,1-2H3.
What are the key properties of 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol?
1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol has a molecular weight of 266.30 g/mol, XLogP of 1.37, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 62015350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).