About 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol
2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol (PubChem CID 62015413) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol |
| PubChem CID | 62015413 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol |
| SMILES | CCCCN(CCO)Cc1csc(CCC)n1 |
| InChI | InChI=1S/C13H24N2OS/c1-3-5-7-15(8-9-16)10-12-11-17-13(14-12)6-4-2/h11,16H,3-10H2,1-2H3 |
| InChIKey | UNJMPBIINIETSN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol?
The IUPAC name of 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol (CID 62015413) is 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol.
What is the SMILES notation for 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol?
The canonical SMILES for 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol is CCCCN(CCO)Cc1csc(CCC)n1.
What is the InChIKey of 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol?
The InChIKey is UNJMPBIINIETSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2OS/c1-3-5-7-15(8-9-16)10-12-11-17-13(14-12)6-4-2/h11,16H,3-10H2,1-2H3.
What are the key properties of 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol?
2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol has a molecular weight of 256.41 g/mol, XLogP of 2.69, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl-[(2-propyl-1,3-thiazol-4-yl)methyl]amino]ethanol is sourced from PubChem (CID 62015413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).