About 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol
1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol (PubChem CID 62016330) has the molecular formula C15H19FN2O3
and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 62016330 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)Cc1coc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H19FN2O3/c1-18(8-14(19)10-20-2)7-13-9-21-15(17-13)11-4-3-5-12(16)6-11/h3-6,9,14,19H,7-8,10H2,1-2H3 |
| InChIKey | QZYBZSOVINNKDQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol (CID 62016330) is 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol is COCC(O)CN(C)Cc1coc(-c2cccc(F)c2)n1.
What is the InChIKey of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol?
The InChIKey is QZYBZSOVINNKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O3/c1-18(8-14(19)10-20-2)7-13-9-21-15(17-13)11-4-3-5-12(16)6-11/h3-6,9,14,19H,7-8,10H2,1-2H3.
What are the key properties of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol?
1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol has a molecular weight of 294.33 g/mol, XLogP of 1.92, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl-methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 62016330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).