C16H17N3O — CID 62016875
[3-(benzimidazol-1-ylmethyl)-4-methoxyphenyl]methanamine (PubChem CID 62016875) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is [3-(benzimidazol-1-ylmethyl)-4-methoxyphenyl]methanamine.
| Compound Name | [3-(benzimidazol-1-ylmethyl)-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 62016875 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [3-(benzimidazol-1-ylmethyl)-4-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN)cc1Cn1cnc2ccccc21 |
| InChI | InChI=1S/C16H17N3O/c1-20-16-7-6-12(9-17)8-13(16)10-19-11-18-14-4-2-3-5-15(14)19/h2-8,11H,9-10,17H2,1H3 |
| InChIKey | ZASIKBRVNIMUAJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |