C12H15N3O2 — CID 62017705
2-(5-oxohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62017705) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(5-oxohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(5-oxohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62017705 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(5-oxohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CC(=O)CCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C12H15N3O2/c1-10(16)6-2-5-9-15-12(17)14-8-4-3-7-11(14)13-15/h3-4,7-8H,2,5-6,9H2,1H3 |
| InChIKey | ZYAGNVGFXBTBQJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|