C13H15Cl2N3 — CID 62017739
3-tert-butyl-5-(2,6-dichlorophenyl)imidazol-4-amine (PubChem CID 62017739) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is 3-tert-butyl-5-(2,6-dichlorophenyl)imidazol-4-amine.
| Compound Name | 3-tert-butyl-5-(2,6-dichlorophenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 62017739 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-tert-butyl-5-(2,6-dichlorophenyl)imidazol-4-amine |
| SMILES | CC(C)(C)n1cnc(-c2c(Cl)cccc2Cl)c1N |
| InChI | InChI=1S/C13H15Cl2N3/c1-13(2,3)18-7-17-11(12(18)16)10-8(14)5-4-6-9(10)15/h4-7H,16H2,1-3H3 |
| InChIKey | OPLSQXZNDMVFNX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |