C13H15F2N3 — CID 62018117
3-butyl-5-(2,4-difluorophenyl)imidazol-4-amine (PubChem CID 62018117) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-butyl-5-(2,4-difluorophenyl)imidazol-4-amine.
| Compound Name | 3-butyl-5-(2,4-difluorophenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 62018117 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-butyl-5-(2,4-difluorophenyl)imidazol-4-amine |
| SMILES | CCCCn1cnc(-c2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C13H15F2N3/c1-2-3-6-18-8-17-12(13(18)16)10-5-4-9(14)7-11(10)15/h4-5,7-8H,2-3,6,16H2,1H3 |
| InChIKey | JKGJGKFIZZQXLB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |