About 3-(2,2-difluoroethoxy)-2,4-dimethylaniline
3-(2,2-difluoroethoxy)-2,4-dimethylaniline (PubChem CID 62018691) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2,4-dimethylaniline.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-2,4-dimethylaniline |
| PubChem CID | 62018691 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2,4-dimethylaniline |
| SMILES | Cc1ccc(N)c(C)c1OCC(F)F |
| InChI | InChI=1S/C10H13F2NO/c1-6-3-4-8(13)7(2)10(6)14-5-9(11)12/h3-4,9H,5,13H2,1-2H3 |
| InChIKey | XWIDHWPONMSUMR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethoxy)-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-2,4-dimethylaniline?
The IUPAC name of 3-(2,2-difluoroethoxy)-2,4-dimethylaniline (CID 62018691) is 3-(2,2-difluoroethoxy)-2,4-dimethylaniline.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-2,4-dimethylaniline?
The canonical SMILES for 3-(2,2-difluoroethoxy)-2,4-dimethylaniline is Cc1ccc(N)c(C)c1OCC(F)F.
What is the InChIKey of 3-(2,2-difluoroethoxy)-2,4-dimethylaniline?
The InChIKey is XWIDHWPONMSUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO/c1-6-3-4-8(13)7(2)10(6)14-5-9(11)12/h3-4,9H,5,13H2,1-2H3.
What are the key properties of 3-(2,2-difluoroethoxy)-2,4-dimethylaniline?
3-(2,2-difluoroethoxy)-2,4-dimethylaniline has a molecular weight of 201.22 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-2,4-dimethylaniline is sourced from PubChem (CID 62018691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).