About 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one (PubChem CID 62018999) has the molecular formula C15H11Br2NO2S
and a molecular weight of 429.13 g/mol. Its IUPAC name is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one |
| PubChem CID | 62018999 |
| Molecular Formula | C15H11Br2NO2S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one |
| SMILES | O=C(CN1C(=O)CCc2ccccc21)c1cc(Br)sc1Br |
| InChI | InChI=1S/C15H11Br2NO2S/c16-13-7-10(15(17)21-13)12(19)8-18-11-4-2-1-3-9(11)5-6-14(18)20/h1-4,7H,5-6,8H2 |
| InChIKey | PBFDTGYNNQZSLQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one?
The IUPAC name of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one (CID 62018999) is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one is O=C(CN1C(=O)CCc2ccccc21)c1cc(Br)sc1Br.
What is the InChIKey of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one?
The InChIKey is PBFDTGYNNQZSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Br2NO2S/c16-13-7-10(15(17)21-13)12(19)8-18-11-4-2-1-3-9(11)5-6-14(18)20/h1-4,7H,5-6,8H2.
What are the key properties of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one?
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one has a molecular weight of 429.13 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 62018999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).