About 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine
5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine (PubChem CID 62019427) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine |
| PubChem CID | 62019427 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine |
| SMILES | COc1ccc(-c2ncn(CC(C)C)c2N)cc1OC |
| InChI | InChI=1S/C15H21N3O2/c1-10(2)8-18-9-17-14(15(18)16)11-5-6-12(19-3)13(7-11)20-4/h5-7,9-10H,8,16H2,1-4H3 |
| InChIKey | HLYKQVWQPZMWOM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine (CID 62019427) is 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine is COc1ccc(-c2ncn(CC(C)C)c2N)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine?
The InChIKey is HLYKQVWQPZMWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-10(2)8-18-9-17-14(15(18)16)11-5-6-12(19-3)13(7-11)20-4/h5-7,9-10H,8,16H2,1-4H3.
What are the key properties of 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine?
5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine has a molecular weight of 275.35 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)imidazol-4-amine is sourced from PubChem (CID 62019427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).