C14H23N3O3S — CID 62020164
2-[(2-aminophenyl)methylsulfonyl-methylamino]-N,N-diethylacetamide (PubChem CID 62020164) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methylsulfonyl-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-aminophenyl)methylsulfonyl-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 62020164 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[(2-aminophenyl)methylsulfonyl-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)S(=O)(=O)Cc1ccccc1N |
| InChI | InChI=1S/C14H23N3O3S/c1-4-17(5-2)14(18)10-16(3)21(19,20)11-12-8-6-7-9-13(12)15/h6-9H,4-5,10-11,15H2,1-3H3 |
| InChIKey | GLBFGGSJQDKSAQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|