About 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol (PubChem CID 62021145) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol |
| PubChem CID | 62021145 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol |
| SMILES | CCc1nnc(CN(CCO)C(C)C)o1 |
| InChI | InChI=1S/C10H19N3O2/c1-4-9-11-12-10(15-9)7-13(5-6-14)8(2)3/h8,14H,4-7H2,1-3H3 |
| InChIKey | XAJQIJLDDBVHGV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol (CID 62021145) is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol.
What is the SMILES notation for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The canonical SMILES for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol is CCc1nnc(CN(CCO)C(C)C)o1.
What is the InChIKey of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The InChIKey is XAJQIJLDDBVHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c1-4-9-11-12-10(15-9)7-13(5-6-14)8(2)3/h8,14H,4-7H2,1-3H3.
What are the key properties of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol has a molecular weight of 213.28 g/mol, XLogP of 0.83, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-propan-2-ylamino]ethanol is sourced from PubChem (CID 62021145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).