About 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole
5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole (PubChem CID 620220) has the molecular formula C9H4F6N4
and a molecular weight of 282.15 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole |
| PubChem CID | 620220 |
| Molecular Formula | C9H4F6N4 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole |
| SMILES | FC(F)(F)c1cc(-c2nn[nH]n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H4F6N4/c10-8(11,12)5-1-4(7-16-18-19-17-7)2-6(3-5)9(13,14)15/h1-3H,(H,16,17,18,19) |
| InChIKey | KKJFZIQEWZVVIV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole (CID 620220) is 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole is FC(F)(F)c1cc(-c2nn[nH]n2)cc(C(F)(F)F)c1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole?
The InChIKey is KKJFZIQEWZVVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F6N4/c10-8(11,12)5-1-4(7-16-18-19-17-7)2-6(3-5)9(13,14)15/h1-3H,(H,16,17,18,19).
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole?
5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole has a molecular weight of 282.15 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-2H-tetrazole is sourced from PubChem (CID 620220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).