C13H19F2NO2 — CID 62022111
2-[[2-(difluoromethoxy)phenyl]methyl-propan-2-ylamino]ethanol (PubChem CID 62022111) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl-propan-2-ylamino]ethanol.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 62022111 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H19F2NO2/c1-10(2)16(7-8-17)9-11-5-3-4-6-12(11)18-13(14)15/h3-6,10,13,17H,7-9H2,1-2H3 |
| InChIKey | KGDDMKRCBAXPFU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |