C14H24N2O3 — CID 62022579
N-(furan-2-ylmethyl)-2-[3-hydroxypropyl(propan-2-yl)amino]-N-methylacetamide (PubChem CID 62022579) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[3-hydroxypropyl(propan-2-yl)amino]-N-methylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[3-hydroxypropyl(propan-2-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 62022579 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[3-hydroxypropyl(propan-2-yl)amino]-N-methylacetamide |
| SMILES | CC(C)N(CCCO)CC(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C14H24N2O3/c1-12(2)16(7-5-8-17)11-14(18)15(3)10-13-6-4-9-19-13/h4,6,9,12,17H,5,7-8,10-11H2,1-3H3 |
| InChIKey | FAMHDJZBTQZUFN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |