C13H11BrN2O4S — CID 62023081
5-bromo-1-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-3-nitropyridin-2-one (PubChem CID 62023081) has the molecular formula C13H11BrN2O4S and a molecular weight of 371.21 g/mol. Its IUPAC name is 5-bromo-1-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-3-nitropyridin-2-one.
| Compound Name | 5-bromo-1-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-3-nitropyridin-2-one |
|---|---|
| PubChem CID | 62023081 |
| Molecular Formula | C13H11BrN2O4S |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 5-bromo-1-[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl]-3-nitropyridin-2-one |
| SMILES | Cc1cc(C(=O)Cn2cc(Br)cc([N+](=O)[O-])c2=O)c(C)s1 |
| InChI | InChI=1S/C13H11BrN2O4S/c1-7-3-10(8(2)21-7)12(17)6-15-5-9(14)4-11(13(15)18)16(19)20/h3-5H,6H2,1-2H3 |
| InChIKey | GRSKXYJBBREWKY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|