C11H10ClNO3S — CID 62023826
1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 62023826) has the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 62023826 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CC(=O)c2ccc(Cl)s2)C1=O |
| InChI | InChI=1S/C11H10ClNO3S/c1-6-4-10(15)13(11(6)16)5-7(14)8-2-3-9(12)17-8/h2-3,6H,4-5H2,1H3 |
| InChIKey | QZEKMOJACLQTMF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|