C14H18FNO2 — CID 62024778
1-(3-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone (PubChem CID 62024778) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 62024778 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC(CO)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H18FNO2/c15-13-3-1-2-12(8-13)14(18)9-16-6-4-11(10-17)5-7-16/h1-3,8,11,17H,4-7,9-10H2 |
| InChIKey | PJDQHUQMZGVFRX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |