C14H7Br2NO3S — CID 62025188
4-bromo-1-[2-(5-bromothiophen-2-yl)-2-oxoethyl]indole-2,3-dione (PubChem CID 62025188) has the molecular formula C14H7Br2NO3S and a molecular weight of 429.09 g/mol. Its IUPAC name is 4-bromo-1-[2-(5-bromothiophen-2-yl)-2-oxoethyl]indole-2,3-dione.
| Compound Name | 4-bromo-1-[2-(5-bromothiophen-2-yl)-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 62025188 |
| Molecular Formula | C14H7Br2NO3S |
| Molecular Weight | 429.09 g/mol |
| Exact Mass | 426.85 |
| IUPAC Name | 4-bromo-1-[2-(5-bromothiophen-2-yl)-2-oxoethyl]indole-2,3-dione |
| SMILES | O=C(CN1C(=O)C(=O)c2c(Br)cccc21)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H7Br2NO3S/c15-7-2-1-3-8-12(7)13(19)14(20)17(8)6-9(18)10-4-5-11(16)21-10/h1-5H,6H2 |
| InChIKey | OHBXWVCGQBJMHK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.09 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|