About 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 62025207) has the molecular formula C10H6Br2N2O3S
and a molecular weight of 394.04 g/mol. Its IUPAC name is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione |
| PubChem CID | 62025207 |
| Molecular Formula | C10H6Br2N2O3S |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 391.85 |
| IUPAC Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H6Br2N2O3S/c11-7-3-5(9(12)18-7)6(15)4-14-2-1-8(16)13-10(14)17/h1-3H,4H2,(H,13,16,17) |
| InChIKey | HRHVKLWNQIOTEG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione?
The IUPAC name of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione (CID 62025207) is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione?
The canonical SMILES for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione is O=C(Cn1ccc(=O)[nH]c1=O)c1cc(Br)sc1Br.
What is the InChIKey of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione?
The InChIKey is HRHVKLWNQIOTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2N2O3S/c11-7-3-5(9(12)18-7)6(15)4-14-2-1-8(16)13-10(14)17/h1-3H,4H2,(H,13,16,17).
What are the key properties of 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione?
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione has a molecular weight of 394.04 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]pyrimidine-2,4-dione is sourced from PubChem (CID 62025207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).