C15H19NO — CID 62025224
3,3-dimethyl-1-(6-methylindol-1-yl)butan-2-one (PubChem CID 62025224) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-(6-methylindol-1-yl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(6-methylindol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 62025224 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3,3-dimethyl-1-(6-methylindol-1-yl)butan-2-one |
| SMILES | Cc1ccc2ccn(CC(=O)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C15H19NO/c1-11-5-6-12-7-8-16(13(12)9-11)10-14(17)15(2,3)4/h5-9H,10H2,1-4H3 |
| InChIKey | IJUGRPHXFBUDSL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |