C14H20F7NO — CID 620271
N-(1-cyclohexylpropan-2-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide (PubChem CID 620271) has the molecular formula C14H20F7NO and a molecular weight of 351.31 g/mol. Its IUPAC name is N-(1-cyclohexylpropan-2-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide.
| Compound Name | N-(1-cyclohexylpropan-2-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 620271 |
| Molecular Formula | C14H20F7NO |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(1-cyclohexylpropan-2-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
| SMILES | CC(CC1CCCCC1)N(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H20F7NO/c1-9(8-10-6-4-3-5-7-10)22(2)11(23)12(15,16)13(17,18)14(19,20)21/h9-10H,3-8H2,1-2H3 |
| InChIKey | BMLFWQFIOJLXPE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|