About 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol
2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol (PubChem CID 62027817) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol |
| PubChem CID | 62027817 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol |
| SMILES | Cc1nnc(CSc2ccccc2O)o1 |
| InChI | InChI=1S/C10H10N2O2S/c1-7-11-12-10(14-7)6-15-9-5-3-2-4-8(9)13/h2-5,13H,6H2,1H3 |
| InChIKey | MOTKXNOLWFOGPH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol?
The IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol (CID 62027817) is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol.
What is the SMILES notation for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol?
The canonical SMILES for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol is Cc1nnc(CSc2ccccc2O)o1.
What is the InChIKey of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol?
The InChIKey is MOTKXNOLWFOGPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-7-11-12-10(14-7)6-15-9-5-3-2-4-8(9)13/h2-5,13H,6H2,1H3.
What are the key properties of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol?
2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol has a molecular weight of 222.27 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol is sourced from PubChem (CID 62027817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).