methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate

C17H19NO3 — CID 62028058

IUPACmethyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate
SMILESCOC(=O)c1ccccc1N(C)Cc1ccc(OC)cc1
InChIInChI=1S/C17H19NO3/c1-18(12-13-8-10-14(20-2)11-9-13)16-7-5-4-6-15(16)17(19)21-3/h4-11H,12H2,1-3H3
InChIKeyREJYYRUEGYSOCE-UHFFFAOYSA-N
MW285.34 g/mol
LogP3.12
Rot. Bonds5

About methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate

methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate (PubChem CID 62028058) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate.

Molecular Properties

Compound Namemethyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate
PubChem CID62028058
Molecular FormulaC17H19NO3
Molecular Weight285.34 g/mol
Exact Mass285.14
IUPAC Namemethyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate
SMILESCOC(=O)c1ccccc1N(C)Cc1ccc(OC)cc1
InChIInChI=1S/C17H19NO3/c1-18(12-13-8-10-14(20-2)11-9-13)16-7-5-4-6-15(16)17(19)21-3/h4-11H,12H2,1-3H3
InChIKeyREJYYRUEGYSOCE-UHFFFAOYSA-N
XLogP3.12
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate?
The IUPAC name of methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate (CID 62028058) is methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate.
What is the SMILES notation for methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate?
The canonical SMILES for methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate is COC(=O)c1ccccc1N(C)Cc1ccc(OC)cc1.
What is the InChIKey of methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate?
The InChIKey is REJYYRUEGYSOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-18(12-13-8-10-14(20-2)11-9-13)16-7-5-4-6-15(16)17(19)21-3/h4-11H,12H2,1-3H3.
What are the key properties of methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate?
methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate has a molecular weight of 285.34 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-methoxyphenyl)methyl-methylamino]benzoate is sourced from PubChem (CID 62028058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).