C15H17BrN2O — CID 62030742
2-[(4-bromophenyl)methyl-methylamino]-1-(1-methylpyrrol-3-yl)ethanone (PubChem CID 62030742) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-1-(1-methylpyrrol-3-yl)ethanone.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-1-(1-methylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 62030742 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-1-(1-methylpyrrol-3-yl)ethanone |
| SMILES | CN(CC(=O)c1ccn(C)c1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H17BrN2O/c1-17-8-7-13(10-17)15(19)11-18(2)9-12-3-5-14(16)6-4-12/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | USXYXOTYHDBPRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |