C11H15NO2S — CID 62031099
2-[cyclopropyl(2-hydroxyethyl)amino]-1-thiophen-2-ylethanone (PubChem CID 62031099) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-[cyclopropyl(2-hydroxyethyl)amino]-1-thiophen-2-ylethanone.
| Compound Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 62031099 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-1-thiophen-2-ylethanone |
| SMILES | O=C(CN(CCO)C1CC1)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c13-6-5-12(9-3-4-9)8-10(14)11-2-1-7-15-11/h1-2,7,9,13H,3-6,8H2 |
| InChIKey | QCRWHBUXSFLUCR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |