C16H14F2O3 — CID 62031147
1-(2,5-difluorophenyl)-2-[(3-methoxyphenyl)methoxy]ethanone (PubChem CID 62031147) has the molecular formula C16H14F2O3 and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[(3-methoxyphenyl)methoxy]ethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-[(3-methoxyphenyl)methoxy]ethanone |
|---|---|
| PubChem CID | 62031147 |
| Molecular Formula | C16H14F2O3 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[(3-methoxyphenyl)methoxy]ethanone |
| SMILES | COc1cccc(COCC(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H14F2O3/c1-20-13-4-2-3-11(7-13)9-21-10-16(19)14-8-12(17)5-6-15(14)18/h2-8H,9-10H2,1H3 |
| InChIKey | OVEQSLPPHZGJTO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |