C8H11N3O3S — CID 62033511
(2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid (PubChem CID 62033511) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62033511 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]propanoic acid |
| SMILES | CCc1nnsc1C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H11N3O3S/c1-3-5-6(15-11-10-5)7(12)9-4(2)8(13)14/h4H,3H2,1-2H3,(H,9,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | QVMQLOFMWXJREU-BYPYZUCNSA-N |
| XLogP | 0.30 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |