5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid

C10H16N4O3 — CID 62034111

IUPAC5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid
SMILESO=C(O)CCCCNC(=O)CCn1cncn1
InChIInChI=1S/C10H16N4O3/c15-9(4-6-14-8-11-7-13-14)12-5-2-1-3-10(16)17/h7-8H,1-6H2,(H,12,15)(H,16,17)
InChIKeyXCMNDIIBJBCDHO-UHFFFAOYSA-N
MW240.26 g/mol
LogP0.04
Rot. Bonds8

About 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid

5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid (PubChem CID 62034111) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid.

Molecular Properties

Compound Name5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid
PubChem CID62034111
Molecular FormulaC10H16N4O3
Molecular Weight240.26 g/mol
Exact Mass240.12
IUPAC Name5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid
SMILESO=C(O)CCCCNC(=O)CCn1cncn1
InChIInChI=1S/C10H16N4O3/c15-9(4-6-14-8-11-7-13-14)12-5-2-1-3-10(16)17/h7-8H,1-6H2,(H,12,15)(H,16,17)
InChIKeyXCMNDIIBJBCDHO-UHFFFAOYSA-N
XLogP0.04
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 50.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid?
The IUPAC name of 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid (CID 62034111) is 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid.
What is the SMILES notation for 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid?
The canonical SMILES for 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid is O=C(O)CCCCNC(=O)CCn1cncn1.
What is the InChIKey of 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid?
The InChIKey is XCMNDIIBJBCDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c15-9(4-6-14-8-11-7-13-14)12-5-2-1-3-10(16)17/h7-8H,1-6H2,(H,12,15)(H,16,17).
What are the key properties of 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid?
5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid has a molecular weight of 240.26 g/mol, XLogP of 0.04, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,2,4-triazol-1-yl)propanoylamino]pentanoic acid is sourced from PubChem (CID 62034111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).