C14H11F3O3 — CID 62034235
1-(3,3,3-trifluoropropoxy)naphthalene-2-carboxylic acid (PubChem CID 62034235) has the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropoxy)naphthalene-2-carboxylic acid.
| Compound Name | 1-(3,3,3-trifluoropropoxy)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 62034235 |
| Molecular Formula | C14H11F3O3 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-(3,3,3-trifluoropropoxy)naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2c1OCCC(F)(F)F |
| InChI | InChI=1S/C14H11F3O3/c15-14(16,17)7-8-20-12-10-4-2-1-3-9(10)5-6-11(12)13(18)19/h1-6H,7-8H2,(H,18,19) |
| InChIKey | GDPAOPDOHSUVJV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |