C15H18ClN3O2 — CID 62035053
1-[5-chloro-2-hydroxy-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]phenyl]ethanone (PubChem CID 62035053) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-[5-chloro-2-hydroxy-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]phenyl]ethanone.
| Compound Name | 1-[5-chloro-2-hydroxy-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 62035053 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[5-chloro-2-hydroxy-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)cc(CN(C)Cc2cnn(C)c2)c1O |
| InChI | InChI=1S/C15H18ClN3O2/c1-10(20)14-5-13(16)4-12(15(14)21)9-18(2)7-11-6-17-19(3)8-11/h4-6,8,21H,7,9H2,1-3H3 |
| InChIKey | JSOBIRAOYQHQRM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|