C14H16ClNOS2 — CID 62036547
1-(5-chlorothiophen-2-yl)-2-[ethyl(thiophen-2-ylmethyl)amino]propan-1-one (PubChem CID 62036547) has the molecular formula C14H16ClNOS2 and a molecular weight of 313.88 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-[ethyl(thiophen-2-ylmethyl)amino]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-[ethyl(thiophen-2-ylmethyl)amino]propan-1-one |
|---|---|
| PubChem CID | 62036547 |
| Molecular Formula | C14H16ClNOS2 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-[ethyl(thiophen-2-ylmethyl)amino]propan-1-one |
| SMILES | CCN(Cc1cccs1)C(C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClNOS2/c1-3-16(9-11-5-4-8-18-11)10(2)14(17)12-6-7-13(15)19-12/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | DPDYUHBDRGFUND-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |