C16H19N5 — CID 62039822
2-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]quinoline-2,6-diamine (PubChem CID 62039822) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]quinoline-2,6-diamine.
| Compound Name | 2-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]quinoline-2,6-diamine |
|---|---|
| PubChem CID | 62039822 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]quinoline-2,6-diamine |
| SMILES | Cc1[nH]ncc1CCCNc1ccc2cc(N)ccc2n1 |
| InChI | InChI=1S/C16H19N5/c1-11-13(10-19-21-11)3-2-8-18-16-7-4-12-9-14(17)5-6-15(12)20-16/h4-7,9-10H,2-3,8,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NPERWMRSYVWGGQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|