C16H21Cl2N3 — CID 62040459
1-(2,4-dichlorophenyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]propan-1-amine (PubChem CID 62040459) has the molecular formula C16H21Cl2N3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]propan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]propan-1-amine |
|---|---|
| PubChem CID | 62040459 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]propan-1-amine |
| SMILES | CCC(NCCCc1cn[nH]c1C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3/c1-3-16(14-7-6-13(17)9-15(14)18)19-8-4-5-12-10-20-21-11(12)2/h6-7,9-10,16,19H,3-5,8H2,1-2H3,(H,20,21) |
| InChIKey | AUCIIGCZIWHCBI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|